CAS 1192344-13-0 is the registry number for N-Boc-3-bromo-D-phenylalanine ethyl ester, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 5g.
Ethyl (2R)-3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1192344-13-0) is a chemical compound with the molecular formula C16H22BrNO4 and a molecular weight of 372.25 g/mol. IUPAC name: ethyl (2R)-3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: ZTVUZOMRSCWUOP-CYBMUJFWSA-N.
| Molecular formula | C16H22BrNO4 |
|---|---|
| Molecular weight | 372.25 g/mol |
| IUPAC name | ethyl (2R)-3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | ZTVUZOMRSCWUOP-CYBMUJFWSA-N |
| SMILES | CCOC(=O)[C@@H](CC1=CC(=CC=C1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)