CAS 1870386-96-1 is the registry number for 1-(4-Bromo-2,5-difluorophenyl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-2,5-difluorophenyl)pyrrolidin-2-one (CAS 1870386-96-1) is a chemical compound with the molecular formula C10H8BrF2NO and a molecular weight of 276.08 g/mol. IUPAC name: 1-(4-bromo-2,5-difluorophenyl)pyrrolidin-2-one. InChIKey: UXWCQXCEIZRGDD-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF2NO |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | 1-(4-bromo-2,5-difluorophenyl)pyrrolidin-2-one |
| InChIKey | UXWCQXCEIZRGDD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CC(=C(C=C2F)Br)F |
Computed by PubChem (NCBI)