Products 2504201-80-1
CAS 2504201-80-1 is the registry number for Azetidin-1-yl(5-bromo-2,4-difluorophenyl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Azetidin-1-yl-(5-bromo-2,4-difluorophenyl)methanone (CAS 2504201-80-1) is a chemical compound with the molecular formula C10H8BrF2NO and a molecular weight of 276.08 g/mol. IUPAC name: azetidin-1-yl-(5-bromo-2,4-difluorophenyl)methanone. InChIKey: RTCFNJJOYFIHDA-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF2NO |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | azetidin-1-yl-(5-bromo-2,4-difluorophenyl)methanone |
| InChIKey | RTCFNJJOYFIHDA-UHFFFAOYSA-N |
| SMILES | C1CN(C1)C(=O)C2=CC(=C(C=C2F)F)Br |
Computed by PubChem (NCBI)