Products 2379322-00-4
CAS 2379322-00-4 appears in our catalog under these names: 4-Bromo-n-cyclopropyl-2,5-difluorobenzamide, 95%, 4-Bromo-N-cyclopropyl-2,5-difluorobenzamide, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
4-bromo-N-cyclopropyl-2,5-difluorobenzamide (CAS 2379322-00-4) is a chemical compound with the molecular formula C10H8BrF2NO and a molecular weight of 276.08 g/mol. IUPAC name: 4-bromo-N-cyclopropyl-2,5-difluorobenzamide. InChIKey: PATRHLJRZCWWHT-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF2NO |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | 4-bromo-N-cyclopropyl-2,5-difluorobenzamide |
| InChIKey | PATRHLJRZCWWHT-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC(=C(C=C2F)Br)F |
Computed by PubChem (NCBI)