CAS 187106-14-5 appears in our catalog under these names: (S)-1-Azaspiro(4.4)nonane-2,6-dione, 97%, (5S)-1-azaspiro[4.4]nonane-2,6-dione, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(5S)-1-azaspiro[4.4]nonane-2,9-dione (CAS 187106-14-5) is a chemical compound with the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. IUPAC name: (5S)-1-azaspiro[4.4]nonane-2,9-dione. InChIKey: LXGWFGOAUWPEFB-QMMMGPOBSA-N.
| Molecular formula | C8H11NO2 |
|---|---|
| Molecular weight | 153.18 g/mol |
| IUPAC name | (5S)-1-azaspiro[4.4]nonane-2,9-dione |
| InChIKey | LXGWFGOAUWPEFB-QMMMGPOBSA-N |
| SMILES | C1CC(=O)[C@]2(C1)CCC(=O)N2 |
Computed by PubChem (NCBI)