CAS 187222-13-5 is the registry number for 3,5-Dimethyl-2-(ethoxycarbonyl)-4-pyrone. Offered by: Biosynth. Available pack sizes: 500mg.
Ethyl 3,5-dimethyl-4-oxopyran-2-carboxylate (CAS 187222-13-5) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: ethyl 3,5-dimethyl-4-oxopyran-2-carboxylate. InChIKey: OUVHQEZDGIOBSW-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | ethyl 3,5-dimethyl-4-oxopyran-2-carboxylate |
| InChIKey | OUVHQEZDGIOBSW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=O)C(=CO1)C)C |
Computed by PubChem (NCBI)