Products 18735-42-7
CAS 18735-42-7 appears in our catalog under these names: N-(4-Amino-2-chlorophenyl)methanesulfonamide, 95%, N-(4-Amino-2-chlorophenyl)methanesulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
N-(4-amino-2-chlorophenyl)methanesulfonamide (CAS 18735-42-7) is a chemical compound with the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. IUPAC name: N-(4-amino-2-chlorophenyl)methanesulfonamide. InChIKey: HPJMGYQKFKWAFD-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2S |
|---|---|
| Molecular weight | 220.68 g/mol |
| IUPAC name | N-(4-amino-2-chlorophenyl)methanesulfonamide |
| InChIKey | HPJMGYQKFKWAFD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)