CAS 187458-77-1 appears in our catalog under these names: (R)-4-Amino-5-methoxy-5-oxopentanoic acid hydrochloride, 95%, (R)–4–Amino–5–methoxy–5–oxopentanoic acid hydrochloride, H-D-Glu-OMe·HCl 95%, (R)-4-Amino-5-methoxy-5-oxopentanoic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 10g, 1g, 5g, 25g.
(4R)-4-amino-5-methoxy-5-oxopentanoic acid;hydrochloride (CAS 187458-77-1) is a chemical compound with the molecular formula C6H12ClNO4 and a molecular weight of 197.62 g/mol. IUPAC name: (4R)-4-amino-5-methoxy-5-oxopentanoic acid;hydrochloride. InChIKey: QXMRXPZMEBBMNW-PGMHMLKASA-N.
| Molecular formula | C6H12ClNO4 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | (4R)-4-amino-5-methoxy-5-oxopentanoic acid;hydrochloride |
| InChIKey | QXMRXPZMEBBMNW-PGMHMLKASA-N |
| SMILES | COC(=O)[C@@H](CCC(=O)O)N.Cl |
Computed by PubChem (NCBI)