CAS 910548-20-8 is the registry number for (2S,3R)-3-Methylglutamic Acid Hydrochloride Salt. Offered by: TRC. Available pack sizes: 1mg.
(2S,3R)-2-amino-3-methylpentanedioic acid;hydrochloride (CAS 910548-20-8) is a chemical compound with the molecular formula C6H12ClNO4 and a molecular weight of 197.62 g/mol. IUPAC name: (2S,3R)-2-amino-3-methylpentanedioic acid;hydrochloride. InChIKey: IJUHLZXMNQGWBG-ZJQZTCRYSA-N.
| Molecular formula | C6H12ClNO4 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-methylpentanedioic acid;hydrochloride |
| InChIKey | IJUHLZXMNQGWBG-ZJQZTCRYSA-N |
| SMILES | C[C@H](CC(=O)O)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)