CAS 250736-84-6 appears in our catalog under these names: O-Acetyl-L-homoserine Hydrochloride, 95%, >95% (HPLC), O-Acetyl-L-homoserine hydrochloride, H-OAc-Hse-OH·HCl 95%, (S)-4-Acetoxy-2-aminobutanoic acid hydrochloride, 95%, 95%, O-Acetyl-L-homoserine (hydrochloride). Offered by: TRC, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 0,005g, 0,002g, 0,01g, 0,025g, 0,05g.
(2S)-4-acetyloxy-2-aminobutanoic acid;hydrochloride (CAS 250736-84-6) is a chemical compound with the molecular formula C6H12ClNO4 and a molecular weight of 197.62 g/mol. IUPAC name: (2S)-4-acetyloxy-2-aminobutanoic acid;hydrochloride. InChIKey: LFZHWEFUZURWRL-JEDNCBNOSA-N.
| Molecular formula | C6H12ClNO4 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | (2S)-4-acetyloxy-2-aminobutanoic acid;hydrochloride |
| InChIKey | LFZHWEFUZURWRL-JEDNCBNOSA-N |
| SMILES | CC(=O)OCC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)