Products 1874642-98-4

CAS 1874642-98-4 is the registry number for tert-Butyl 4-bromo-1-methyl-1H-1,2,3-triazole-5-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 5-bromo-3-methyltriazole-4-carboxylate (CAS 1874642-98-4) is a chemical compound with the molecular formula C8H12BrN3O2 and a molecular weight of 262.10 g/mol. IUPAC name: tert-butyl 5-bromo-3-methyltriazole-4-carboxylate. InChIKey: NWAMGDCKEOHHCY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12BrN3O2
Molecular weight262.10 g/mol
IUPAC nametert-butyl 5-bromo-3-methyltriazole-4-carboxylate
InChIKeyNWAMGDCKEOHHCY-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(N=NN1C)Br

Computed by PubChem (NCBI)