CAS 1874642-98-4 is the registry number for tert-Butyl 4-bromo-1-methyl-1H-1,2,3-triazole-5-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 5-bromo-3-methyltriazole-4-carboxylate (CAS 1874642-98-4) is a chemical compound with the molecular formula C8H12BrN3O2 and a molecular weight of 262.10 g/mol. IUPAC name: tert-butyl 5-bromo-3-methyltriazole-4-carboxylate. InChIKey: NWAMGDCKEOHHCY-UHFFFAOYSA-N.
| Molecular formula | C8H12BrN3O2 |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | tert-butyl 5-bromo-3-methyltriazole-4-carboxylate |
| InChIKey | NWAMGDCKEOHHCY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(N=NN1C)Br |
Computed by PubChem (NCBI)