CAS 734546-69-1 is the registry number for 6-Amino-5-bromo-3-methyl-1-propyl-1h-pyrimidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
6-amino-5-bromo-3-methyl-1-propylpyrimidine-2,4-dione (CAS 734546-69-1) is a chemical compound with the molecular formula C8H12BrN3O2 and a molecular weight of 262.10 g/mol. IUPAC name: 6-amino-5-bromo-3-methyl-1-propylpyrimidine-2,4-dione. InChIKey: GEFIEODHEDWDMO-UHFFFAOYSA-N.
| Molecular formula | C8H12BrN3O2 |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | 6-amino-5-bromo-3-methyl-1-propylpyrimidine-2,4-dione |
| InChIKey | GEFIEODHEDWDMO-UHFFFAOYSA-N |
| SMILES | CCCN1C(=C(C(=O)N(C1=O)C)Br)N |
Computed by PubChem (NCBI)