CAS 571155-34-5 is the registry number for 6-Amino-5-bromo-1-(2-methylpropyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-amino-5-bromo-1-(2-methylpropyl)pyrimidine-2,4-dione (CAS 571155-34-5) is a chemical compound with the molecular formula C8H12BrN3O2 and a molecular weight of 262.10 g/mol. IUPAC name: 6-amino-5-bromo-1-(2-methylpropyl)pyrimidine-2,4-dione. InChIKey: BLGXNRDFTXINIM-UHFFFAOYSA-N.
| Molecular formula | C8H12BrN3O2 |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | 6-amino-5-bromo-1-(2-methylpropyl)pyrimidine-2,4-dione |
| InChIKey | BLGXNRDFTXINIM-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C(=C(C(=O)NC1=O)Br)N |
Computed by PubChem (NCBI)