CAS 18749-30-9 appears in our catalog under these names: H-DL-Trp(6-OH)-OH 98%, 2-Amino-3-(6-hydroxy-1H-indol-3-yl)propanoic acid, 98%, 98%, 2-Amino-3-(6-hydroxy-1H-indol-3-yl)propanoic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-amino-3-(6-hydroxy-1H-indol-3-yl)propanoic acid (CAS 18749-30-9) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 2-amino-3-(6-hydroxy-1H-indol-3-yl)propanoic acid. InChIKey: NXANGIZFHQQBCC-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2-amino-3-(6-hydroxy-1H-indol-3-yl)propanoic acid |
| InChIKey | NXANGIZFHQQBCC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)NC=C2CC(C(=O)O)N |
Computed by PubChem (NCBI)