CAS 1875-48-5 appears in our catalog under these names: N-Aminophthalimide, 94% , N-Aminophthalimide, >98.0%(HPLC), 2-Aminoisoindoline-1,3-dione 97%, N-AMINOPHTHALIMIDE, TECH., 90%, 2-Aminoisoindoline-1,3-dione, 97%, 97%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 10g, 50g, 25g, 1g, 100g, 500g, 1000g.
2-aminoisoindole-1,3-dione (CAS 1875-48-5) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 2-aminoisoindole-1,3-dione. InChIKey: KSILMCDYDAKOJD-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 2-aminoisoindole-1,3-dione |
| InChIKey | KSILMCDYDAKOJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)N |
Computed by PubChem (NCBI)