CAS 1878-80-4 appears in our catalog under these names: (3-Acetylphenoxy)acetic acid, 95%, (3–Acetylphenoxy)acetic Acid, (3-Acetylphenoxy)acetic acid, (3-Acetylphenoxy)acetic Acid, >98.0%(GC)(T), (3-Acetylphenoxy)acetic Acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100mg, 250mg, 500mg.
2-(3-acetylphenoxy)acetic acid (CAS 1878-80-4) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-(3-acetylphenoxy)acetic acid. InChIKey: VDZJGFDUSYCVJA-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-(3-acetylphenoxy)acetic acid |
| InChIKey | VDZJGFDUSYCVJA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)OCC(=O)O |
Computed by PubChem (NCBI)