Products 1878-81-5
CAS 1878-81-5 appears in our catalog under these names: 4-Acetylphenoxyacetic acid, 95%, 4-Acetylphenoxyacetic acid/ 98%, (4–Acetylphenoxy)acetic Acid, 4-Acetylphenoxyacetic acid, (4-Acetylphenoxy)acetic Acid, >98.0%(GC)(T). Offered by: Combi-blocks, Chemat, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 1g, 5g, 100g, 0,25g, 2,5g, 250mg, 500mg.
2-(4-acetylphenoxy)acetic acid (CAS 1878-81-5) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-(4-acetylphenoxy)acetic acid. InChIKey: KMXZEXUYXUMHEQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-(4-acetylphenoxy)acetic acid |
| InChIKey | KMXZEXUYXUMHEQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(p-Acetylphenoxy)acetic acid, Acetic acid, (4-acetylphenoxy)-, 4-Acetylphenoxyacetic acid, 2-(4-acetylphenoxy)acetic acid, (4-Acetylphenoxy)acetic Acid, Acetic acid, 2-(4-acetylphenoxy)-, P-ACETYLPHENOXYACETIC ACID, (4-Acetylphenyloxy)acetic acid, (4-Acetyl-phenoxy)-acetic acid, 4-Acetylphenoxyacetic acid, 99%