Products 187932-50-9
CAS 187932-50-9 appears in our catalog under these names: 6-Bromo-3'-nitroflavone, 95%, 6-Bromo-3’-nitroflavone, >95% (HPLC), 6-BROMO-3'-NITROFLAVONE, 95%+, 95%+. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g.
6-bromo-2-(3-nitrophenyl)chromen-4-one (CAS 187932-50-9) is a chemical compound with the molecular formula C15H8BrNO4 and a molecular weight of 346.13 g/mol. IUPAC name: 6-bromo-2-(3-nitrophenyl)chromen-4-one. InChIKey: IPHSQMSRIWZULE-UHFFFAOYSA-N.
| Molecular formula | C15H8BrNO4 |
|---|---|
| Molecular weight | 346.13 g/mol |
| IUPAC name | 6-bromo-2-(3-nitrophenyl)chromen-4-one |
| InChIKey | IPHSQMSRIWZULE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC(=O)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)