CAS 294194-23-3 is the registry number for 2-(5-Bromo-1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(5-bromo-1,3-dioxoisoindol-2-yl)benzoic acid (CAS 294194-23-3) is a chemical compound with the molecular formula C15H8BrNO4 and a molecular weight of 346.13 g/mol. IUPAC name: 2-(5-bromo-1,3-dioxoisoindol-2-yl)benzoic acid. InChIKey: TZYBWCVCNGCYJD-UHFFFAOYSA-N.
| Molecular formula | C15H8BrNO4 |
|---|---|
| Molecular weight | 346.13 g/mol |
| IUPAC name | 2-(5-bromo-1,3-dioxoisoindol-2-yl)benzoic acid |
| InChIKey | TZYBWCVCNGCYJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N2C(=O)C3=C(C2=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)