Products 294194-23-3

CAS 294194-23-3 is the registry number for 2-(5-Bromo-1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(5-bromo-1,3-dioxoisoindol-2-yl)benzoic acid (CAS 294194-23-3) is a chemical compound with the molecular formula C15H8BrNO4 and a molecular weight of 346.13 g/mol. IUPAC name: 2-(5-bromo-1,3-dioxoisoindol-2-yl)benzoic acid. InChIKey: TZYBWCVCNGCYJD-UHFFFAOYSA-N.

Identity
Molecular formulaC15H8BrNO4
Molecular weight346.13 g/mol
IUPAC name2-(5-bromo-1,3-dioxoisoindol-2-yl)benzoic acid
InChIKeyTZYBWCVCNGCYJD-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)N2C(=O)C3=C(C2=O)C=C(C=C3)Br

Computed by PubChem (NCBI)