Products 413594-59-9

CAS 413594-59-9 is the registry number for 1,3-Dioxoisoindolin-2-yl 4-bromobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(1,3-dioxoisoindol-2-yl) 4-bromobenzoate (CAS 413594-59-9) is a chemical compound with the molecular formula C15H8BrNO4 and a molecular weight of 346.13 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 4-bromobenzoate. InChIKey: KECWZZBVSLEWKP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H8BrNO4
Molecular weight346.13 g/mol
IUPAC name(1,3-dioxoisoindol-2-yl) 4-bromobenzoate
InChIKeyKECWZZBVSLEWKP-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)OC(=O)C3=CC=C(C=C3)Br

Computed by PubChem (NCBI)