CAS 413594-59-9 is the registry number for 1,3-Dioxoisoindolin-2-yl 4-bromobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1,3-dioxoisoindol-2-yl) 4-bromobenzoate (CAS 413594-59-9) is a chemical compound with the molecular formula C15H8BrNO4 and a molecular weight of 346.13 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 4-bromobenzoate. InChIKey: KECWZZBVSLEWKP-UHFFFAOYSA-N.
| Molecular formula | C15H8BrNO4 |
|---|---|
| Molecular weight | 346.13 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 4-bromobenzoate |
| InChIKey | KECWZZBVSLEWKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OC(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)