CAS 18800-99-2 is the registry number for 2,6-Di-tert-butylanthracene-9,10-dione, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-ditert-butylanthracene-9,10-dione (CAS 18800-99-2) is a chemical compound with the molecular formula C22H24O2 and a molecular weight of 320.4 g/mol. IUPAC name: 2,6-ditert-butylanthracene-9,10-dione. InChIKey: KJSNKHXDFLXHPS-UHFFFAOYSA-N.
| Molecular formula | C22H24O2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 2,6-ditert-butylanthracene-9,10-dione |
| InChIKey | KJSNKHXDFLXHPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C(=O)C3=C(C2=O)C=CC(=C3)C(C)(C)C |
Computed by PubChem (NCBI)