CAS 37677-93-3 appears in our catalog under these names: 4,4'-(1,3-Adamantanediyl)diphenol, 95%, 4,4'-(Adamantane-1,3-diyl)diphenol 97%, 4,4'-(ADAMANTANE-1,3-DIYL)DIPHENOL, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol (CAS 37677-93-3) is a chemical compound with the molecular formula C22H24O2 and a molecular weight of 320.4 g/mol. IUPAC name: 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol. InChIKey: DNLWYVQYADCTEU-UHFFFAOYSA-N.
| Molecular formula | C22H24O2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol |
| InChIKey | DNLWYVQYADCTEU-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)C4=CC=C(C=C4)O)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)