Products 24620-40-4

CAS 24620-40-4 is the registry number for 2,7-Di-tert-butylphenanthrene-9,10-dione 95%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,7-ditert-butylphenanthrene-9,10-dione (CAS 24620-40-4) is a chemical compound with the molecular formula C22H24O2 and a molecular weight of 320.4 g/mol. IUPAC name: 2,7-ditert-butylphenanthrene-9,10-dione. InChIKey: YCUNZGWKZODMHG-UHFFFAOYSA-N.

Identity
Molecular formulaC22H24O2
Molecular weight320.4 g/mol
IUPAC name2,7-ditert-butylphenanthrene-9,10-dione
InChIKeyYCUNZGWKZODMHG-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC2=C(C=C1)C3=C(C=C(C=C3)C(C)(C)C)C(=O)C2=O

Computed by PubChem (NCBI)