CAS 24620-40-4 is the registry number for 2,7-Di-tert-butylphenanthrene-9,10-dione 95%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
2,7-ditert-butylphenanthrene-9,10-dione (CAS 24620-40-4) is a chemical compound with the molecular formula C22H24O2 and a molecular weight of 320.4 g/mol. IUPAC name: 2,7-ditert-butylphenanthrene-9,10-dione. InChIKey: YCUNZGWKZODMHG-UHFFFAOYSA-N.
| Molecular formula | C22H24O2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 2,7-ditert-butylphenanthrene-9,10-dione |
| InChIKey | YCUNZGWKZODMHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C3=C(C=C(C=C3)C(C)(C)C)C(=O)C2=O |
Computed by PubChem (NCBI)