Products 188027-95-4
CAS 188027-95-4 appears in our catalog under these names: 2,7-Dichloroxanthene-9-carboxylic acid, 95%, 95%, 2,7-Dichloro-9H-xanthene-9-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
2,7-dichloro-9H-xanthene-9-carboxylic acid (CAS 188027-95-4) is a chemical compound with the molecular formula C14H8Cl2O3 and a molecular weight of 295.1 g/mol. IUPAC name: 2,7-dichloro-9H-xanthene-9-carboxylic acid. InChIKey: OCUBZGSJBOWQLF-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2O3 |
|---|---|
| Molecular weight | 295.1 g/mol |
| IUPAC name | 2,7-dichloro-9H-xanthene-9-carboxylic acid |
| InChIKey | OCUBZGSJBOWQLF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(C3=C(O2)C=CC(=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)