Products 443737-22-2
CAS 443737-22-2 appears in our catalog under these names: 3-Formylphenyl 2,4-dichlorobenzoate, 95%, 3-Formylphenyl 2,4-dichlorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(3-formylphenyl) 2,4-dichlorobenzoate (CAS 443737-22-2) is a chemical compound with the molecular formula C14H8Cl2O3 and a molecular weight of 295.1 g/mol. IUPAC name: (3-formylphenyl) 2,4-dichlorobenzoate. InChIKey: NYEOOFCETKEGDM-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2O3 |
|---|---|
| Molecular weight | 295.1 g/mol |
| IUPAC name | (3-formylphenyl) 2,4-dichlorobenzoate |
| InChIKey | NYEOOFCETKEGDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(=O)C2=C(C=C(C=C2)Cl)Cl)C=O |
Computed by PubChem (NCBI)