Products 790-41-0
CAS 790-41-0 appears in our catalog under these names: 4-Chlorobenzoic anhydride, >95% (HPLC), 4–Chlorobenzoic anhydride, 4-Chlorobenzoic anhydride 97%, 4-Chlorobenzoic anhydride, 97%, 97%, 4-Chlorobenzoic anhydride, 97%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 10g, 1g, 25g, 5g, 100g.
(4-chlorobenzoyl) 4-chlorobenzoate (CAS 790-41-0) is a chemical compound with the molecular formula C14H8Cl2O3 and a molecular weight of 295.1 g/mol. IUPAC name: (4-chlorobenzoyl) 4-chlorobenzoate. InChIKey: MWUSAETYTBNPDG-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2O3 |
|---|---|
| Molecular weight | 295.1 g/mol |
| IUPAC name | (4-chlorobenzoyl) 4-chlorobenzoate |
| InChIKey | MWUSAETYTBNPDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC(=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Bis(4-chlorobenzoic) anhydride, Benzoic acid, 4-chloro-, anhydride, Benzoic acid, 4-chloro-, 1,1'-anhydride, 4-Chlorobenzoic anhydride, p-Chlorobenzoic anhydride, 4-chlorobenzoicanhydride, (4-chlorobenzoyl) 4-chlorobenzoate, p-Chlorobenzoic acid anhydride, Benzoic acid, p-chloro-, anhydride, 4-Chlorobenzoic acid anhydride