CAS 1881275-70-2 is the registry number for (1R,2R,4S)-Methyl 7-azabicyclo[2.2.1]heptane-2-carboxylate oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
Methyl (1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2-carboxylate;oxalic acid (CAS 1881275-70-2) is a chemical compound with the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. IUPAC name: methyl (1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2-carboxylate;oxalic acid. InChIKey: CYQRNEXAKCLPOG-VWZUFWLJSA-N.
| Molecular formula | C10H15NO6 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | methyl (1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2-carboxylate;oxalic acid |
| InChIKey | CYQRNEXAKCLPOG-VWZUFWLJSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CC[C@H]1N2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)