Products 1881275-70-2

CAS 1881275-70-2 is the registry number for (1R,2R,4S)-Methyl 7-azabicyclo[2.2.1]heptane-2-carboxylate oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2-carboxylate;oxalic acid (CAS 1881275-70-2) is a chemical compound with the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. IUPAC name: methyl (1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2-carboxylate;oxalic acid. InChIKey: CYQRNEXAKCLPOG-VWZUFWLJSA-N.

Identity
Molecular formulaC10H15NO6
Molecular weight245.23 g/mol
IUPAC namemethyl (1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2-carboxylate;oxalic acid
InChIKeyCYQRNEXAKCLPOG-VWZUFWLJSA-N
SMILESCOC(=O)[C@@H]1C[C@@H]2CC[C@H]1N2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)