CAS 2202948-77-2 is the registry number for Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate;oxalic acid (CAS 2202948-77-2) is a chemical compound with the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. IUPAC name: ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate;oxalic acid. InChIKey: UNDQIGOLLPQSIF-UHFFFAOYSA-N.
| Molecular formula | C10H15NO6 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate;oxalic acid |
| InChIKey | UNDQIGOLLPQSIF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2C1CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)