Products 2202948-77-2

CAS 2202948-77-2 is the registry number for Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate;oxalic acid (CAS 2202948-77-2) is a chemical compound with the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. IUPAC name: ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate;oxalic acid. InChIKey: UNDQIGOLLPQSIF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15NO6
Molecular weight245.23 g/mol
IUPAC nameethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate;oxalic acid
InChIKeyUNDQIGOLLPQSIF-UHFFFAOYSA-N
SMILESCCOC(=O)C1C2C1CNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)