Products 65318-21-0
CAS 65318-21-0 is the registry number for Mycosporine glycine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[(5S)-5-hydroxy-5-(hydroxymethyl)-2-methoxy-3-oxocyclohexen-1-yl]amino]acetic acid (CAS 65318-21-0) is a chemical compound with the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. IUPAC name: 2-[[(5S)-5-hydroxy-5-(hydroxymethyl)-2-methoxy-3-oxocyclohexen-1-yl]amino]acetic acid. InChIKey: XZQILKYKJYHEHD-JTQLQIEISA-N.
| Molecular formula | C10H15NO6 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 2-[[(5S)-5-hydroxy-5-(hydroxymethyl)-2-methoxy-3-oxocyclohexen-1-yl]amino]acetic acid |
| InChIKey | XZQILKYKJYHEHD-JTQLQIEISA-N |
| SMILES | COC1=C(C[C@](CC1=O)(CO)O)NCC(=O)O |
Computed by PubChem (NCBI)