CAS 1881288-93-2 is the registry number for 1-chloro-3-(2,2-dimethylpropoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-chloro-3-(2,2-dimethylpropoxy)benzene (CAS 1881288-93-2) is a chemical compound with the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. IUPAC name: 1-chloro-3-(2,2-dimethylpropoxy)benzene. InChIKey: BIYRBZOSBHNURI-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | 1-chloro-3-(2,2-dimethylpropoxy)benzene |
| InChIKey | BIYRBZOSBHNURI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)COC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)