CAS 2094-72-6 appears in our catalog under these names: 1-Adamantanecarbonyl chloride, 95%, Adamantane-1-carbonyl chloride, 97% , 1-Adamantanecarboxylic acid chloride, 97%, 1-Adamantanecarbonyl Chloride, >97.0%(GC)(T), 1-Adamantanecarbonyl chloride 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 10g, 50g, 100g, 500g.
Adamantane-1-carbonyl chloride (CAS 2094-72-6) is a chemical compound with the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. IUPAC name: adamantane-1-carbonyl chloride. InChIKey: MIBQYWIOHFTKHD-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | adamantane-1-carbonyl chloride |
| InChIKey | MIBQYWIOHFTKHD-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)Cl |
Computed by PubChem (NCBI)