CAS 42024-40-8 appears in our catalog under these names: 1-(4-Chlorophenyl)-3-methylbutan-2-ol, 95%, 1–(4–chlorophenyl)–3–methylbutan–2–ol, 1-(4-chlorophenyl)-3-methylbutan-2-ol, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(4-chlorophenyl)-3-methylbutan-2-ol (CAS 42024-40-8) is a chemical compound with the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-methylbutan-2-ol. InChIKey: CBAJDMVADUVMKD-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-methylbutan-2-ol |
| InChIKey | CBAJDMVADUVMKD-UHFFFAOYSA-N |
| SMILES | CC(C)C(CC1=CC=C(C=C1)Cl)O |
Computed by PubChem (NCBI)