CAS 1881292-64-3 is the registry number for 3,4-dichloro-2-(cyclopentyloxy)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,4-dichloro-2-cyclopentyloxypyridine (CAS 1881292-64-3) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 3,4-dichloro-2-cyclopentyloxypyridine. InChIKey: JYBBYCTZQIYUKL-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 3,4-dichloro-2-cyclopentyloxypyridine |
| InChIKey | JYBBYCTZQIYUKL-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=NC=CC(=C2Cl)Cl |
Computed by PubChem (NCBI)