Products 1951441-34-1
CAS 1951441-34-1 appears in our catalog under these names: 2-(5-Chlorobenzofuran-3-yl)ethanamine hydrochloride, 95%, 2-(5-Chlorobenzofuran-3-yl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-(5-chloro-1-benzofuran-3-yl)ethanamine;hydrochloride (CAS 1951441-34-1) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 2-(5-chloro-1-benzofuran-3-yl)ethanamine;hydrochloride. InChIKey: UNCVAXXVOSLUTN-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 2-(5-chloro-1-benzofuran-3-yl)ethanamine;hydrochloride |
| InChIKey | UNCVAXXVOSLUTN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CO2)CCN.Cl |
Computed by PubChem (NCBI)