CAS 39086-64-1 is the registry number for 2-Chloro-n-(3-chlorobenzyl)-n-methylacetamide, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-[(3-chlorophenyl)methyl]-N-methylacetamide (CAS 39086-64-1) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 2-chloro-N-[(3-chlorophenyl)methyl]-N-methylacetamide. InChIKey: XEOQNIRKKCEMOT-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 2-chloro-N-[(3-chlorophenyl)methyl]-N-methylacetamide |
| InChIKey | XEOQNIRKKCEMOT-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC(=CC=C1)Cl)C(=O)CCl |
Computed by PubChem (NCBI)