CAS 1881293-12-4 is the registry number for 2-(benzyloxy)-1,4-dichloro-3-fluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,4-dichloro-2-fluoro-3-phenylmethoxybenzene (CAS 1881293-12-4) is a chemical compound with the molecular formula C13H9Cl2FO and a molecular weight of 271.11 g/mol. IUPAC name: 1,4-dichloro-2-fluoro-3-phenylmethoxybenzene. InChIKey: KZTCQSXUAWBADZ-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2FO |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 1,4-dichloro-2-fluoro-3-phenylmethoxybenzene |
| InChIKey | KZTCQSXUAWBADZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2F)Cl)Cl |
Computed by PubChem (NCBI)