CAS 1881295-81-3 is the registry number for 1-(benzyloxy)-2,3-dichloro-4-fluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,3-dichloro-1-fluoro-4-phenylmethoxybenzene (CAS 1881295-81-3) is a chemical compound with the molecular formula C13H9Cl2FO and a molecular weight of 271.11 g/mol. IUPAC name: 2,3-dichloro-1-fluoro-4-phenylmethoxybenzene. InChIKey: WHGHOMUPMCPLKD-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2FO |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 2,3-dichloro-1-fluoro-4-phenylmethoxybenzene |
| InChIKey | WHGHOMUPMCPLKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)Cl)Cl |
Computed by PubChem (NCBI)