Products 2270246-98-3
CAS 2270246-98-3 is the registry number for 2-(benzyloxy)-1,3-dichloro-5-fluorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dichloro-5-fluoro-2-phenylmethoxybenzene (CAS 2270246-98-3) is a chemical compound with the molecular formula C13H9Cl2FO and a molecular weight of 271.11 g/mol. IUPAC name: 1,3-dichloro-5-fluoro-2-phenylmethoxybenzene. InChIKey: QHJXZSUGHLFGOI-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2FO |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 1,3-dichloro-5-fluoro-2-phenylmethoxybenzene |
| InChIKey | QHJXZSUGHLFGOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Cl)F)Cl |
Computed by PubChem (NCBI)