Products 1881293-29-3
CAS 1881293-29-3 is the registry number for tert-butyl N-(3,4-dichlorophenyl)-N-methylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl N-(3,4-dichlorophenyl)-N-methylcarbamate (CAS 1881293-29-3) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: tert-butyl N-(3,4-dichlorophenyl)-N-methylcarbamate. InChIKey: APDGOSZTHCRLSQ-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | tert-butyl N-(3,4-dichlorophenyl)-N-methylcarbamate |
| InChIKey | APDGOSZTHCRLSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)