CAS 1049733-75-6 appears in our catalog under these names: (2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%, (2S,4R)–4–(3–Chlorobenzyl)pyrrolidine–2–carboxylic acid hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
(2S,4R)-4-[(3-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049733-75-6) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: (2S,4R)-4-[(3-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: DJTLAJDJECIWLN-XQKZEKTMSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | (2S,4R)-4-[(3-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | DJTLAJDJECIWLN-XQKZEKTMSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)