CAS 1359731-74-0 appears in our catalog under these names: 1-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid hydrochloride, 95%, 1-((4-Chlorophenyl)methyl)pyrrolidine-2-carboxylic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1359731-74-0) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: GGRAEEGVXPCLLZ-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | GGRAEEGVXPCLLZ-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)CC2=CC=C(C=C2)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)