CAS 1049740-99-9 is the registry number for (R)-Alpha-(3-chloro-benzyl)-proline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2R)-2-[(3-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049740-99-9) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: (2R)-2-[(3-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: PYMQPNPTFZYFAC-UTONKHPSSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | (2R)-2-[(3-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | PYMQPNPTFZYFAC-UTONKHPSSA-N |
| SMILES | C1C[C@@](NC1)(CC2=CC(=CC=C2)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)