Products 1881295-15-3
CAS 1881295-15-3 is the registry number for 3-chloro-6-(cyclohexyloxy)-2-fluoropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-6-cyclohexyloxy-2-fluoropyridine (CAS 1881295-15-3) is a chemical compound with the molecular formula C11H13ClFNO and a molecular weight of 229.68 g/mol. IUPAC name: 3-chloro-6-cyclohexyloxy-2-fluoropyridine. InChIKey: LUXXGSGODLWHRN-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 3-chloro-6-cyclohexyloxy-2-fluoropyridine |
| InChIKey | LUXXGSGODLWHRN-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)OC2=NC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)