Products 2270912-31-5
CAS 2270912-31-5 is the registry number for 3-Fluoro-4-(1,2,3,6-tetrahydro-pyridin-4-yl)-phenol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenol;hydrochloride (CAS 2270912-31-5) is a chemical compound with the molecular formula C11H13ClFNO and a molecular weight of 229.68 g/mol. IUPAC name: 3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenol;hydrochloride. InChIKey: YQPYUQZTNNZTOV-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenol;hydrochloride |
| InChIKey | YQPYUQZTNNZTOV-UHFFFAOYSA-N |
| SMILES | C1CNCC=C1C2=C(C=C(C=C2)O)F.Cl |
Computed by PubChem (NCBI)