CAS 852290-34-7 appears in our catalog under these names: 3-[(4-Fluorophenyl)carbonyl]pyrrolidine hydrochloride, 98%, 3-(4-Fluorobenzoyl)pyrrolidine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.
(4-fluorophenyl)-pyrrolidin-3-ylmethanone;hydrochloride (CAS 852290-34-7) is a chemical compound with the molecular formula C11H13ClFNO and a molecular weight of 229.68 g/mol. IUPAC name: (4-fluorophenyl)-pyrrolidin-3-ylmethanone;hydrochloride. InChIKey: YXRXEUZSEUHRLR-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | (4-fluorophenyl)-pyrrolidin-3-ylmethanone;hydrochloride |
| InChIKey | YXRXEUZSEUHRLR-UHFFFAOYSA-N |
| SMILES | C1CNCC1C(=O)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)