CAS 1881321-40-9 is the registry number for 4-chloro-1H-indazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-chloro-1H-indazole;hydrochloride (CAS 1881321-40-9) is a chemical compound with the molecular formula C7H6Cl2N2 and a molecular weight of 189.04 g/mol. IUPAC name: 4-chloro-1H-indazole;hydrochloride. InChIKey: VQRXRFZHFZVTBM-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2 |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 4-chloro-1H-indazole;hydrochloride |
| InChIKey | VQRXRFZHFZVTBM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NN2)C(=C1)Cl.Cl |
Computed by PubChem (NCBI)