CAS 3797-84-0 is the registry number for 2,6-Dichloro-benzamidine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
2,6-dichlorobenzenecarboximidamide (CAS 3797-84-0) is a chemical compound with the molecular formula C7H6Cl2N2 and a molecular weight of 189.04 g/mol. IUPAC name: 2,6-dichlorobenzenecarboximidamide. InChIKey: PQVLZHJNFSEYOS-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2 |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 2,6-dichlorobenzenecarboximidamide |
| InChIKey | PQVLZHJNFSEYOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=N)N)Cl |
Computed by PubChem (NCBI)