CAS 769061-91-8 appears in our catalog under these names: 2,3-Dichlorobenzamidine, 95%, 2,3-Dichlorobenzimidamide, 95+%, 2,3–Dichlorobenzimidamide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2,3-dichlorobenzenecarboximidamide (CAS 769061-91-8) is a chemical compound with the molecular formula C7H6Cl2N2 and a molecular weight of 189.04 g/mol. IUPAC name: 2,3-dichlorobenzenecarboximidamide. InChIKey: AJVCKUGPVGPLRM-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2 |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 2,3-dichlorobenzenecarboximidamide |
| InChIKey | AJVCKUGPVGPLRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=N)N |
Computed by PubChem (NCBI)