Products 1881322-13-9
CAS 1881322-13-9 is the registry number for 2-chloro-4-fluoro-1-[(4-fluorophenyl)methoxy]benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-4-fluoro-1-[(4-fluorophenyl)methoxy]benzene (CAS 1881322-13-9) is a chemical compound with the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. IUPAC name: 2-chloro-4-fluoro-1-[(4-fluorophenyl)methoxy]benzene. InChIKey: DLJHNHZBNZGNCM-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF2O |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 2-chloro-4-fluoro-1-[(4-fluorophenyl)methoxy]benzene |
| InChIKey | DLJHNHZBNZGNCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=C(C=C(C=C2)F)Cl)F |
Computed by PubChem (NCBI)