Products 1881292-89-2
CAS 1881292-89-2 is the registry number for 1-(benzyloxy)-5-chloro-2,4-difluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-chloro-2,4-difluoro-5-phenylmethoxybenzene (CAS 1881292-89-2) is a chemical compound with the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. IUPAC name: 1-chloro-2,4-difluoro-5-phenylmethoxybenzene. InChIKey: HUUCXKJFBIYLID-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF2O |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 1-chloro-2,4-difluoro-5-phenylmethoxybenzene |
| InChIKey | HUUCXKJFBIYLID-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2F)F)Cl |
Computed by PubChem (NCBI)